C16H23N3OS — CID 117163856
3-(3-methoxypropyl)-2-(thian-3-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117163856) has the molecular formula C16H23N3OS and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-(thian-3-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 3-(3-methoxypropyl)-2-(thian-3-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117163856 |
| Molecular Formula | C16H23N3OS |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-(3-methoxypropyl)-2-(thian-3-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | COCCCn1c(CC2CCCSC2)nc2cccnc21 |
| InChI | InChI=1S/C16H23N3OS/c1-20-9-4-8-19-15(11-13-5-3-10-21-12-13)18-14-6-2-7-17-16(14)19/h2,6-7,13H,3-5,8-12H2,1H3 |
| InChIKey | XHNLPEJKMMNGNV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|