C16H16N4S — CID 117164787
2-pyridin-2-yl-3-(thiolan-3-ylmethyl)imidazo[4,5-b]pyridine (PubChem CID 117164787) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 2-pyridin-2-yl-3-(thiolan-3-ylmethyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-pyridin-2-yl-3-(thiolan-3-ylmethyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117164787 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-pyridin-2-yl-3-(thiolan-3-ylmethyl)imidazo[4,5-b]pyridine |
| SMILES | c1ccc(-c2nc3cccnc3n2CC2CCSC2)nc1 |
| InChI | InChI=1S/C16H16N4S/c1-2-7-17-13(4-1)16-19-14-5-3-8-18-15(14)20(16)10-12-6-9-21-11-12/h1-5,7-8,12H,6,9-11H2 |
| InChIKey | FBKYUIOJYMJCCI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |