C14H19N3O3S — CID 11716536
tert-butyl N-[(2S)-1-(cyanomethylamino)-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate (PubChem CID 11716536) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(cyanomethylamino)-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(cyanomethylamino)-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11716536 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | tert-butyl N-[(2S)-1-(cyanomethylamino)-1-oxo-3-thiophen-2-ylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cccs1)C(=O)NCC#N |
| InChI | InChI=1S/C14H19N3O3S/c1-14(2,3)20-13(19)17-11(12(18)16-7-6-15)9-10-5-4-8-21-10/h4-5,8,11H,7,9H2,1-3H3,(H,16,18)(H,17,19)/t11-/m0/s1 |
| InChIKey | YVHNCUDZYGRDIA-NSHDSACASA-N |
| XLogP | 1.82 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|