C15H18O7 — CID 11716547
(1S,2R,6R,10R,11R,14S)-10,14-dihydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadecane-3,9,13-trione (PubChem CID 11716547) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (1S,2R,6R,10R,11R,14S)-10,14-dihydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadecane-3,9,13-trione.
| Compound Name | (1S,2R,6R,10R,11R,14S)-10,14-dihydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadecane-3,9,13-trione |
|---|---|
| PubChem CID | 11716547 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (1S,2R,6R,10R,11R,14S)-10,14-dihydroxy-2,6-dimethyl-8,12-dioxatetracyclo[9.3.1.01,5.06,10]pentadecane-3,9,13-trione |
| SMILES | C[C@H]1C(=O)CC2[C@@]13C[C@@H](OC(=O)[C@H]3O)[C@@]1(O)C(=O)OC[C@@]21C |
| InChI | InChI=1S/C15H18O7/c1-6-7(16)3-8-13(2)5-21-12(19)15(13,20)9-4-14(6,8)10(17)11(18)22-9/h6,8-10,17,20H,3-5H2,1-2H3/t6-,8?,9+,10+,13-,14+,15+/m0/s1 |
| InChIKey | XQZCRYQJNNAQBL-RMYALWHJSA-N |
| XLogP | -0.82 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |