C16H14FN3O — CID 117166582
2-(3-fluorophenyl)-3-(oxolan-3-yl)imidazo[4,5-b]pyridine (PubChem CID 117166582) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-3-(oxolan-3-yl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(3-fluorophenyl)-3-(oxolan-3-yl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 117166582 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(3-fluorophenyl)-3-(oxolan-3-yl)imidazo[4,5-b]pyridine |
| SMILES | Fc1cccc(-c2nc3cccnc3n2C2CCOC2)c1 |
| InChI | InChI=1S/C16H14FN3O/c17-12-4-1-3-11(9-12)15-19-14-5-2-7-18-16(14)20(15)13-6-8-21-10-13/h1-5,7,9,13H,6,8,10H2 |
| InChIKey | JFXGCIMYKJKGIF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |