About 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine
1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine (PubChem CID 11716739) has the molecular formula C19H17FN4
and a molecular weight of 320.37 g/mol. Its IUPAC name is 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine.
Molecular Properties
| Compound Name | 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine |
| PubChem CID | 11716739 |
| Molecular Formula | C19H17FN4 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine |
| SMILES | Cc1cc(N2CCCc3ccc(-c4ccccc4)nc32)nc(F)n1 |
| InChI | InChI=1S/C19H17FN4/c1-13-12-17(23-19(20)21-13)24-11-5-8-15-9-10-16(22-18(15)24)14-6-3-2-4-7-14/h2-4,6-7,9-10,12H,5,8,11H2,1H3 |
| InChIKey | PIWOMGYMWUZCHK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine?
The IUPAC name of 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine (CID 11716739) is 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine.
What is the SMILES notation for 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine?
The canonical SMILES for 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine is Cc1cc(N2CCCc3ccc(-c4ccccc4)nc32)nc(F)n1.
What is the InChIKey of 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine?
The InChIKey is PIWOMGYMWUZCHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN4/c1-13-12-17(23-19(20)21-13)24-11-5-8-15-9-10-16(22-18(15)24)14-6-3-2-4-7-14/h2-4,6-7,9-10,12H,5,8,11H2,1H3.
What are the key properties of 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine?
1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine has a molecular weight of 320.37 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoro-6-methylpyrimidin-4-yl)-7-phenyl-3,4-dihydro-2H-1,8-naphthyridine is sourced from PubChem (CID 11716739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).