About 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol
2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol (PubChem CID 117168940) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol |
| PubChem CID | 117168940 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol |
| SMILES | OCCC1COC(C2CCCCN2)O1 |
| InChI | InChI=1S/C10H19NO3/c12-6-4-8-7-13-10(14-8)9-3-1-2-5-11-9/h8-12H,1-7H2 |
| InChIKey | VFLDZLVAPPMXFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol?
The IUPAC name of 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol (CID 117168940) is 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol.
What is the SMILES notation for 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol?
The canonical SMILES for 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol is OCCC1COC(C2CCCCN2)O1.
What is the InChIKey of 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol?
The InChIKey is VFLDZLVAPPMXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c12-6-4-8-7-13-10(14-8)9-3-1-2-5-11-9/h8-12H,1-7H2.
What are the key properties of 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol?
2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol has a molecular weight of 201.27 g/mol, XLogP of 0.25, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol is sourced from PubChem (CID 117168940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).