C10H19NO3 — CID 117168940
2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol (PubChem CID 117168940) has the molecular formula C10H19NO3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol.
| Compound Name | 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol |
|---|---|
| PubChem CID | 117168940 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 2-(2-piperidin-2-yl-1,3-dioxolan-4-yl)ethanol |
| SMILES | OCCC1COC(C2CCCCN2)O1 |
| InChI | InChI=1S/C10H19NO3/c12-6-4-8-7-13-10(14-8)9-3-1-2-5-11-9/h8-12H,1-7H2 |
| InChIKey | VFLDZLVAPPMXFT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |