C20H21N5 — CID 11716955
4-[2-[(5-methyl-1H-imidazol-4-yl)methyl]diazinan-1-yl]naphthalene-1-carbonitrile (PubChem CID 11716955) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[2-[(5-methyl-1H-imidazol-4-yl)methyl]diazinan-1-yl]naphthalene-1-carbonitrile.
| Compound Name | 4-[2-[(5-methyl-1H-imidazol-4-yl)methyl]diazinan-1-yl]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11716955 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 4-[2-[(5-methyl-1H-imidazol-4-yl)methyl]diazinan-1-yl]naphthalene-1-carbonitrile |
| SMILES | Cc1[nH]cnc1CN1CCCCN1c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C20H21N5/c1-15-19(23-14-22-15)13-24-10-4-5-11-25(24)20-9-8-16(12-21)17-6-2-3-7-18(17)20/h2-3,6-9,14H,4-5,10-11,13H2,1H3,(H,22,23) |
| InChIKey | BXWPKZWAHZTCOU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |