About 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol
2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol (PubChem CID 117169661) has the molecular formula C14H20O4
and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol |
| PubChem CID | 117169661 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol |
| SMILES | COc1ccc(CC2(C)OCC(CCO)O2)cc1 |
| InChI | InChI=1S/C14H20O4/c1-14(17-10-13(18-14)7-8-15)9-11-3-5-12(16-2)6-4-11/h3-6,13,15H,7-10H2,1-2H3 |
| InChIKey | ZIOQVKLGVYSTOA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol?
The IUPAC name of 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol (CID 117169661) is 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol.
What is the SMILES notation for 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol?
The canonical SMILES for 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol is COc1ccc(CC2(C)OCC(CCO)O2)cc1.
What is the InChIKey of 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol?
The InChIKey is ZIOQVKLGVYSTOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-14(17-10-13(18-14)7-8-15)9-11-3-5-12(16-2)6-4-11/h3-6,13,15H,7-10H2,1-2H3.
What are the key properties of 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol?
2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol has a molecular weight of 252.31 g/mol, XLogP of 1.75, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(4-methoxyphenyl)methyl]-2-methyl-1,3-dioxolan-4-yl]ethanol is sourced from PubChem (CID 117169661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).