About methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate
methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate (PubChem CID 117169995) has the molecular formula C14H15F3O4
and a molecular weight of 304.26 g/mol. Its IUPAC name is methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate.
Molecular Properties
| Compound Name | methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate |
| PubChem CID | 117169995 |
| Molecular Formula | C14H15F3O4 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)CC1COC(C)(c2ccc(C(F)(F)F)cc2)O1 |
| InChI | InChI=1S/C14H15F3O4/c1-13(20-8-11(21-13)7-12(18)19-2)9-3-5-10(6-4-9)14(15,16)17/h3-6,11H,7-8H2,1-2H3 |
| InChIKey | ITUHKPQFWZCKMX-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate?
The IUPAC name of methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate (CID 117169995) is methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate?
The canonical SMILES for methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate is COC(=O)CC1COC(C)(c2ccc(C(F)(F)F)cc2)O1.
What is the InChIKey of methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate?
The InChIKey is ITUHKPQFWZCKMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15F3O4/c1-13(20-8-11(21-13)7-12(18)19-2)9-3-5-10(6-4-9)14(15,16)17/h3-6,11H,7-8H2,1-2H3.
What are the key properties of methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate?
methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate has a molecular weight of 304.26 g/mol, XLogP of 2.86, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dioxolan-4-yl]acetate is sourced from PubChem (CID 117169995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).