About 1-aminopropane-2-thiol
1-aminopropane-2-thiol (PubChem CID 11717) has the molecular formula C3H9NS
and a molecular weight of 91.18 g/mol. Its IUPAC name is 1-aminopropane-2-thiol.
Molecular Properties
| Compound Name | 1-aminopropane-2-thiol |
| PubChem CID | 11717 |
| Molecular Formula | C3H9NS |
| Molecular Weight | 91.18 g/mol |
| Exact Mass | 91.05 |
| IUPAC Name | 1-aminopropane-2-thiol |
| SMILES | CC(S)CN |
| InChI | InChI=1S/C3H9NS/c1-3(5)2-4/h3,5H,2,4H2,1H3 |
| InChIKey | MHJPNBAEWSRKBK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 91.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropane-2-thiol?
The IUPAC name of 1-aminopropane-2-thiol (CID 11717) is 1-aminopropane-2-thiol.
What is the SMILES notation for 1-aminopropane-2-thiol?
The canonical SMILES for 1-aminopropane-2-thiol is CC(S)CN.
What is the InChIKey of 1-aminopropane-2-thiol?
The InChIKey is MHJPNBAEWSRKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NS/c1-3(5)2-4/h3,5H,2,4H2,1H3.
What are the key properties of 1-aminopropane-2-thiol?
1-aminopropane-2-thiol has a molecular weight of 91.18 g/mol, XLogP of 0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropane-2-thiol is sourced from PubChem (CID 11717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).