About 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile
2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile (PubChem CID 117170025) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile.
Molecular Properties
| Compound Name | 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile |
| PubChem CID | 117170025 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile |
| SMILES | N#CCC1COC(c2ccc(O)cc2)O1 |
| InChI | InChI=1S/C11H11NO3/c12-6-5-10-7-14-11(15-10)8-1-3-9(13)4-2-8/h1-4,10-11,13H,5,7H2 |
| InChIKey | NBLBYJMOUFINEJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile?
The IUPAC name of 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile (CID 117170025) is 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile.
What is the SMILES notation for 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile?
The canonical SMILES for 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile is N#CCC1COC(c2ccc(O)cc2)O1.
What is the InChIKey of 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile?
The InChIKey is NBLBYJMOUFINEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c12-6-5-10-7-14-11(15-10)8-1-3-9(13)4-2-8/h1-4,10-11,13H,5,7H2.
What are the key properties of 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile?
2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile has a molecular weight of 205.21 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-hydroxyphenyl)-1,3-dioxolan-4-yl]acetonitrile is sourced from PubChem (CID 117170025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).