C19H22ClFO2 — CID 11717031
(2S,4aS,4bR,10bS,12aS)-9-chloro-2-fluoro-8-hydroxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one (PubChem CID 11717031) has the molecular formula C19H22ClFO2 and a molecular weight of 336.83 g/mol. Its IUPAC name is (2S,4aS,4bR,10bS,12aS)-9-chloro-2-fluoro-8-hydroxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one.
| Compound Name | (2S,4aS,4bR,10bS,12aS)-9-chloro-2-fluoro-8-hydroxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one |
|---|---|
| PubChem CID | 11717031 |
| Molecular Formula | C19H22ClFO2 |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | (2S,4aS,4bR,10bS,12aS)-9-chloro-2-fluoro-8-hydroxy-12a-methyl-2,3,4,4a,4b,5,6,10b,11,12-decahydrochrysen-1-one |
| SMILES | C[C@]12CC[C@@H]3c4cc(Cl)c(O)cc4CC[C@H]3[C@@H]1CC[C@H](F)C2=O |
| InChI | InChI=1S/C19H22ClFO2/c1-19-7-6-11-12(14(19)4-5-16(21)18(19)23)3-2-10-8-17(22)15(20)9-13(10)11/h8-9,11-12,14,16,22H,2-7H2,1H3/t11-,12+,14-,16-,19-/m0/s1 |
| InChIKey | GZRXGNUTMBHTLP-IVVREXLCSA-N |
| XLogP | 4.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |