C19H24ClNOS — CID 11717264
3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[1-(4-chlorophenyl)sulfanylcyclopropyl]methanone (PubChem CID 11717264) has the molecular formula C19H24ClNOS and a molecular weight of 349.93 g/mol. Its IUPAC name is 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[1-(4-chlorophenyl)sulfanylcyclopropyl]methanone.
| Compound Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[1-(4-chlorophenyl)sulfanylcyclopropyl]methanone |
|---|---|
| PubChem CID | 11717264 |
| Molecular Formula | C19H24ClNOS |
| Molecular Weight | 349.93 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl-[1-(4-chlorophenyl)sulfanylcyclopropyl]methanone |
| SMILES | O=C(N1CCCC2CCCCC21)C1(Sc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H24ClNOS/c20-15-7-9-16(10-8-15)23-19(11-12-19)18(22)21-13-3-5-14-4-1-2-6-17(14)21/h7-10,14,17H,1-6,11-13H2 |
| InChIKey | YNDBVTREHJJWAT-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.93 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |