C21H34ClNO — CID 11717302
1-[4-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butyl]-4-methylpiperidine;hydrochloride (PubChem CID 11717302) has the molecular formula C21H34ClNO and a molecular weight of 351.96 g/mol. Its IUPAC name is 1-[4-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butyl]-4-methylpiperidine;hydrochloride.
| Compound Name | 1-[4-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butyl]-4-methylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 11717302 |
| Molecular Formula | C21H34ClNO |
| Molecular Weight | 351.96 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | 1-[4-(6-methoxy-1,2,3,4-tetrahydronaphthalen-1-yl)butyl]-4-methylpiperidine;hydrochloride |
| SMILES | COc1ccc2c(c1)CCCC2CCCCN1CCC(C)CC1.Cl |
| InChI | InChI=1S/C21H33NO.ClH/c1-17-11-14-22(15-12-17)13-4-3-6-18-7-5-8-19-16-20(23-2)9-10-21(18)19;/h9-10,16-18H,3-8,11-15H2,1-2H3;1H |
| InChIKey | PFKYXLHAXYCXQP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.96 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|