C12H13FN2 — CID 117173075
N-[(4-fluoro-1H-indol-2-yl)methyl]cyclopropanamine (PubChem CID 117173075) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is N-[(4-fluoro-1H-indol-2-yl)methyl]cyclopropanamine.
| Compound Name | N-[(4-fluoro-1H-indol-2-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 117173075 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | N-[(4-fluoro-1H-indol-2-yl)methyl]cyclopropanamine |
| SMILES | Fc1cccc2[nH]c(CNC3CC3)cc12 |
| InChI | InChI=1S/C12H13FN2/c13-11-2-1-3-12-10(11)6-9(15-12)7-14-8-4-5-8/h1-3,6,8,14-15H,4-5,7H2 |
| InChIKey | ZQXAMHVBGVPJPR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |