C13H15NO2S — CID 117174139
1-propan-2-yl-2-(sulfanylmethyl)indole-4-carboxylic acid (PubChem CID 117174139) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-propan-2-yl-2-(sulfanylmethyl)indole-4-carboxylic acid.
| Compound Name | 1-propan-2-yl-2-(sulfanylmethyl)indole-4-carboxylic acid |
|---|---|
| PubChem CID | 117174139 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-propan-2-yl-2-(sulfanylmethyl)indole-4-carboxylic acid |
| SMILES | CC(C)n1c(CS)cc2c(C(=O)O)cccc21 |
| InChI | InChI=1S/C13H15NO2S/c1-8(2)14-9(7-17)6-11-10(13(15)16)4-3-5-12(11)14/h3-6,8,17H,7H2,1-2H3,(H,15,16) |
| InChIKey | PNRPCWYEXDZWEZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|