C13H14ClNO2S — CID 117176118
5-chloro-2-(pyrrolidin-1-ylmethyl)-1-benzothiophene 1,1-dioxide (PubChem CID 117176118) has the molecular formula C13H14ClNO2S and a molecular weight of 283.78 g/mol. Its IUPAC name is 5-chloro-2-(pyrrolidin-1-ylmethyl)-1-benzothiophene 1,1-dioxide.
| Compound Name | 5-chloro-2-(pyrrolidin-1-ylmethyl)-1-benzothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 117176118 |
| Molecular Formula | C13H14ClNO2S |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 5-chloro-2-(pyrrolidin-1-ylmethyl)-1-benzothiophene 1,1-dioxide |
| SMILES | O=S1(=O)C(CN2CCCC2)=Cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H14ClNO2S/c14-11-3-4-13-10(7-11)8-12(18(13,16)17)9-15-5-1-2-6-15/h3-4,7-8H,1-2,5-6,9H2 |
| InChIKey | CHVUBOSCRKXVDX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |