C11H12O5S2 — CID 117176143
2-(ethylsulfonylmethyl)-1,1-dioxo-1-benzothiophen-5-ol (PubChem CID 117176143) has the molecular formula C11H12O5S2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(ethylsulfonylmethyl)-1,1-dioxo-1-benzothiophen-5-ol.
| Compound Name | 2-(ethylsulfonylmethyl)-1,1-dioxo-1-benzothiophen-5-ol |
|---|---|
| PubChem CID | 117176143 |
| Molecular Formula | C11H12O5S2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-(ethylsulfonylmethyl)-1,1-dioxo-1-benzothiophen-5-ol |
| SMILES | CCS(=O)(=O)CC1=Cc2cc(O)ccc2S1(=O)=O |
| InChI | InChI=1S/C11H12O5S2/c1-2-17(13,14)7-10-6-8-5-9(12)3-4-11(8)18(10,15)16/h3-6,12H,2,7H2,1H3 |
| InChIKey | YIEMCTQSTVYUDU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |