C27H32N6O2 — CID 1171766
3-[[(1-benzyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one (PubChem CID 1171766) has the molecular formula C27H32N6O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 3-[[(1-benzyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[[(1-benzyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 1171766 |
| Molecular Formula | C27H32N6O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | 3-[[(1-benzyltetrazol-5-yl)methyl-cyclohexylamino]methyl]-6-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3nnnn3Cc3ccccc3)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C27H32N6O2/c1-2-35-24-13-14-25-21(16-24)15-22(27(34)28-25)18-32(23-11-7-4-8-12-23)19-26-29-30-31-33(26)17-20-9-5-3-6-10-20/h3,5-6,9-10,13-16,23H,2,4,7-8,11-12,17-19H2,1H3,(H,28,34) |
| InChIKey | HKLRQURVVJNBJE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |