C21H25N5O2 — CID 11717832
2,4-bis(2-methylpropyl)-7-phenyl-6H-purino[7,8-a]imidazole-1,3-dione (PubChem CID 11717832) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2,4-bis(2-methylpropyl)-7-phenyl-6H-purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2,4-bis(2-methylpropyl)-7-phenyl-6H-purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 11717832 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2,4-bis(2-methylpropyl)-7-phenyl-6H-purino[7,8-a]imidazole-1,3-dione |
| SMILES | CC(C)Cn1c(=O)c2c(nc3[nH]c(-c4ccccc4)cn32)n(CC(C)C)c1=O |
| InChI | InChI=1S/C21H25N5O2/c1-13(2)10-25-18-17(19(27)26(21(25)28)11-14(3)4)24-12-16(22-20(24)23-18)15-8-6-5-7-9-15/h5-9,12-14H,10-11H2,1-4H3,(H,22,23) |
| InChIKey | ZMSOKXUTNKJYQK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |