C15H22N2O — CID 117178798
[3-(ethoxymethyl)-1-propan-2-ylindol-6-yl]methanamine (PubChem CID 117178798) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is [3-(ethoxymethyl)-1-propan-2-ylindol-6-yl]methanamine.
| Compound Name | [3-(ethoxymethyl)-1-propan-2-ylindol-6-yl]methanamine |
|---|---|
| PubChem CID | 117178798 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [3-(ethoxymethyl)-1-propan-2-ylindol-6-yl]methanamine |
| SMILES | CCOCc1cn(C(C)C)c2cc(CN)ccc12 |
| InChI | InChI=1S/C15H22N2O/c1-4-18-10-13-9-17(11(2)3)15-7-12(8-16)5-6-14(13)15/h5-7,9,11H,4,8,10,16H2,1-3H3 |
| InChIKey | CTBORWATGXNRNY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |