C20H17NO7 — CID 11717914
7-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one (PubChem CID 11717914) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is 7-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one.
| Compound Name | 7-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
|---|---|
| PubChem CID | 11717914 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 7-[6-(methoxymethoxymethyl)-1,3-benzodioxol-5-yl]-6H-[1,3]dioxolo[4,5-g]isoquinolin-5-one |
| SMILES | COCOCc1cc2c(cc1-c1cc3cc4c(cc3c(=O)[nH]1)OCO4)OCO2 |
| InChI | InChI=1S/C20H17NO7/c1-23-8-24-7-12-4-17-18(27-10-26-17)5-13(12)15-2-11-3-16-19(28-9-25-16)6-14(11)20(22)21-15/h2-6H,7-10H2,1H3,(H,21,22) |
| InChIKey | GKKZRJZILCBVAV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|