C18H17NO4 — CID 117179171
1-ethyl-3-[(2-hydroxyphenoxy)methyl]indole-6-carboxylic acid (PubChem CID 117179171) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 1-ethyl-3-[(2-hydroxyphenoxy)methyl]indole-6-carboxylic acid.
| Compound Name | 1-ethyl-3-[(2-hydroxyphenoxy)methyl]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 117179171 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 1-ethyl-3-[(2-hydroxyphenoxy)methyl]indole-6-carboxylic acid |
| SMILES | CCn1cc(COc2ccccc2O)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C18H17NO4/c1-2-19-10-13(11-23-17-6-4-3-5-16(17)20)14-8-7-12(18(21)22)9-15(14)19/h3-10,20H,2,11H2,1H3,(H,21,22) |
| InChIKey | SYXGXRXGBWLVPP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |