C12H14N2O — CID 117179242
2-[(cyclopropylamino)methyl]-1-benzofuran-6-amine (PubChem CID 117179242) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 2-[(cyclopropylamino)methyl]-1-benzofuran-6-amine.
| Compound Name | 2-[(cyclopropylamino)methyl]-1-benzofuran-6-amine |
|---|---|
| PubChem CID | 117179242 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[(cyclopropylamino)methyl]-1-benzofuran-6-amine |
| SMILES | Nc1ccc2cc(CNC3CC3)oc2c1 |
| InChI | InChI=1S/C12H14N2O/c13-9-2-1-8-5-11(15-12(8)6-9)7-14-10-3-4-10/h1-2,5-6,10,14H,3-4,7,13H2 |
| InChIKey | PXTBEGLBTOFNSD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|