About [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine
[1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine (PubChem CID 117179495) has the molecular formula C13H17NO4S2
and a molecular weight of 315.42 g/mol. Its IUPAC name is [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine.
Molecular Properties
| Compound Name | [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine |
| PubChem CID | 117179495 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine |
| SMILES | CC(C)S(=O)(=O)CC1=Cc2ccc(CN)cc2S1(=O)=O |
| InChI | InChI=1S/C13H17NO4S2/c1-9(2)19(15,16)8-12-6-11-4-3-10(7-14)5-13(11)20(12,17)18/h3-6,9H,7-8,14H2,1-2H3 |
| InChIKey | DXOZDQYFPYSSBX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine?
The IUPAC name of [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine (CID 117179495) is [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine.
What is the SMILES notation for [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine?
The canonical SMILES for [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine is CC(C)S(=O)(=O)CC1=Cc2ccc(CN)cc2S1(=O)=O.
What is the InChIKey of [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine?
The InChIKey is DXOZDQYFPYSSBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4S2/c1-9(2)19(15,16)8-12-6-11-4-3-10(7-14)5-13(11)20(12,17)18/h3-6,9H,7-8,14H2,1-2H3.
What are the key properties of [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine?
[1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine has a molecular weight of 315.42 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-dioxo-2-(propan-2-ylsulfonylmethyl)-1-benzothiophen-6-yl]methanamine is sourced from PubChem (CID 117179495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).