C19H35NO5Si — CID 11717977
N-[(3aS,4S,5R,6R,6aS)-6-hydroxy-4-triethylsilyloxyspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide (PubChem CID 11717977) has the molecular formula C19H35NO5Si and a molecular weight of 385.58 g/mol. Its IUPAC name is N-[(3aS,4S,5R,6R,6aS)-6-hydroxy-4-triethylsilyloxyspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide.
| Compound Name | N-[(3aS,4S,5R,6R,6aS)-6-hydroxy-4-triethylsilyloxyspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide |
|---|---|
| PubChem CID | 11717977 |
| Molecular Formula | C19H35NO5Si |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | N-[(3aS,4S,5R,6R,6aS)-6-hydroxy-4-triethylsilyloxyspiro[4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole-2,1'-cyclohexane]-5-yl]acetamide |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@H](NC(C)=O)[C@@H](O)[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C19H35NO5Si/c1-5-26(6-2,7-3)25-16-14(20-13(4)21)15(22)17-18(16)24-19(23-17)11-9-8-10-12-19/h14-18,22H,5-12H2,1-4H3,(H,20,21)/t14-,15-,16+,17+,18-/m1/s1 |
| InChIKey | ZAOFDSPSPIKSPJ-DFBDCSAJSA-N |
| XLogP | 2.70 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|