C23H30O5 — CID 11718001
(1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-methylphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol (PubChem CID 11718001) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-methylphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-methylphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11718001 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2-methylphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
| SMILES | CCc1ccc(Cc2ccc(C)c([C@]3(O)C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)cc1 |
| InChI | InChI=1S/C23H30O5/c1-3-15-6-8-16(9-7-15)10-17-5-4-14(2)19(11-17)23(28)12-18(13-24)20(25)21(26)22(23)27/h4-9,11,18,20-22,24-28H,3,10,12-13H2,1-2H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | JKLWFGZQDNLBKB-DODNOZFWSA-N |
| XLogP | 1.43 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |