C17H15NO4 — CID 117180416
2-[(3-methoxyphenoxy)methyl]-1H-indole-6-carboxylic acid (PubChem CID 117180416) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is 2-[(3-methoxyphenoxy)methyl]-1H-indole-6-carboxylic acid.
| Compound Name | 2-[(3-methoxyphenoxy)methyl]-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 117180416 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[(3-methoxyphenoxy)methyl]-1H-indole-6-carboxylic acid |
| SMILES | COc1cccc(OCc2cc3ccc(C(=O)O)cc3[nH]2)c1 |
| InChI | InChI=1S/C17H15NO4/c1-21-14-3-2-4-15(9-14)22-10-13-7-11-5-6-12(17(19)20)8-16(11)18-13/h2-9,18H,10H2,1H3,(H,19,20) |
| InChIKey | FRMOZPJLIQGEIG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |