C12H13NO2S — CID 117180439
1-methyl-2-(methylsulfanylmethyl)indole-6-carboxylic acid (PubChem CID 117180439) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-methyl-2-(methylsulfanylmethyl)indole-6-carboxylic acid.
| Compound Name | 1-methyl-2-(methylsulfanylmethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 117180439 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-methyl-2-(methylsulfanylmethyl)indole-6-carboxylic acid |
| SMILES | CSCc1cc2ccc(C(=O)O)cc2n1C |
| InChI | InChI=1S/C12H13NO2S/c1-13-10(7-16-2)5-8-3-4-9(12(14)15)6-11(8)13/h3-6H,7H2,1-2H3,(H,14,15) |
| InChIKey | MAXCCRGXCPRIFO-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |