C16H12O5 — CID 117181173
3-[(3-hydroxyphenoxy)methyl]-1-benzofuran-7-carboxylic acid (PubChem CID 117181173) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 3-[(3-hydroxyphenoxy)methyl]-1-benzofuran-7-carboxylic acid.
| Compound Name | 3-[(3-hydroxyphenoxy)methyl]-1-benzofuran-7-carboxylic acid |
|---|---|
| PubChem CID | 117181173 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[(3-hydroxyphenoxy)methyl]-1-benzofuran-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2c(COc3cccc(O)c3)coc12 |
| InChI | InChI=1S/C16H12O5/c17-11-3-1-4-12(7-11)20-8-10-9-21-15-13(10)5-2-6-14(15)16(18)19/h1-7,9,17H,8H2,(H,18,19) |
| InChIKey | AKAPDDUITWUOFJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |