About N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine
N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine (PubChem CID 117182931) has the molecular formula C15H20N2O2S
and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine.
Molecular Properties
| Compound Name | N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine |
| PubChem CID | 117182931 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine |
| SMILES | NCc1cccc2c1S(=O)(=O)C(CNC1CCCC1)=C2 |
| InChI | InChI=1S/C15H20N2O2S/c16-9-12-5-3-4-11-8-14(20(18,19)15(11)12)10-17-13-6-1-2-7-13/h3-5,8,13,17H,1-2,6-7,9-10,16H2 |
| InChIKey | SAJYTHFGYYDWED-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine?
The IUPAC name of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine (CID 117182931) is N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine.
What is the SMILES notation for N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine?
The canonical SMILES for N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine is NCc1cccc2c1S(=O)(=O)C(CNC1CCCC1)=C2.
What is the InChIKey of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine?
The InChIKey is SAJYTHFGYYDWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2S/c16-9-12-5-3-4-11-8-14(20(18,19)15(11)12)10-17-13-6-1-2-7-13/h3-5,8,13,17H,1-2,6-7,9-10,16H2.
What are the key properties of N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine?
N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine has a molecular weight of 292.40 g/mol, XLogP of 1.81, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[7-(aminomethyl)-1,1-dioxo-1-benzothiophen-2-yl]methyl]cyclopentanamine is sourced from PubChem (CID 117182931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).