C12H15NO2S2 — CID 117183075
1,1-dioxo-2-(propan-2-ylsulfanylmethyl)-1-benzothiophen-7-amine (PubChem CID 117183075) has the molecular formula C12H15NO2S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 1,1-dioxo-2-(propan-2-ylsulfanylmethyl)-1-benzothiophen-7-amine.
| Compound Name | 1,1-dioxo-2-(propan-2-ylsulfanylmethyl)-1-benzothiophen-7-amine |
|---|---|
| PubChem CID | 117183075 |
| Molecular Formula | C12H15NO2S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 1,1-dioxo-2-(propan-2-ylsulfanylmethyl)-1-benzothiophen-7-amine |
| SMILES | CC(C)SCC1=Cc2cccc(N)c2S1(=O)=O |
| InChI | InChI=1S/C12H15NO2S2/c1-8(2)16-7-10-6-9-4-3-5-11(13)12(9)17(10,14)15/h3-6,8H,7,13H2,1-2H3 |
| InChIKey | YYMXKLORUQVSQT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|