C19H19ClN4O4 — CID 11718335
ethyl 3-[2-[(3-chlorobenzoyl)amino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanoate (PubChem CID 11718335) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is ethyl 3-[2-[(3-chlorobenzoyl)amino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[2-[(3-chlorobenzoyl)amino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 11718335 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | ethyl 3-[2-[(3-chlorobenzoyl)amino]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1CCc2nc(NC(=O)c3cccc(Cl)c3)ncc2C1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-2-28-17(26)9-16(25)24-7-6-15-13(11-24)10-21-19(22-15)23-18(27)12-4-3-5-14(20)8-12/h3-5,8,10H,2,6-7,9,11H2,1H3,(H,21,22,23,27) |
| InChIKey | HODAIMBJNLUBMF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|