About N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide
N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide (PubChem CID 11718337) has the molecular formula C22H27ClN2OS
and a molecular weight of 402.99 g/mol. Its IUPAC name is N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide.
Molecular Properties
| Compound Name | N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide |
| PubChem CID | 11718337 |
| Molecular Formula | C22H27ClN2OS |
| Molecular Weight | 402.99 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@H](CSCC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C22H27ClN2OS/c1-25-12-11-21(18-7-9-20(23)10-8-18)19(14-25)15-27-16-22(26)24-13-17-5-3-2-4-6-17/h2-10,19,21H,11-16H2,1H3,(H,24,26)/t19-,21+/m0/s1 |
| InChIKey | LAZPRLXGVMZIOA-PZJWPPBQSA-N |
| XLogP | 4.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.99 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide?
The IUPAC name of N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide (CID 11718337) is N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide.
What is the SMILES notation for N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide?
The canonical SMILES for N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide is CN1CC[C@H](c2ccc(Cl)cc2)[C@H](CSCC(=O)NCc2ccccc2)C1.
What is the InChIKey of N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide?
The InChIKey is LAZPRLXGVMZIOA-PZJWPPBQSA-N. The full InChI is InChI=1S/C22H27ClN2OS/c1-25-12-11-21(18-7-9-20(23)10-8-18)19(14-25)15-27-16-22(26)24-13-17-5-3-2-4-6-17/h2-10,19,21H,11-16H2,1H3,(H,24,26)/t19-,21+/m0/s1.
What are the key properties of N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide?
N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide has a molecular weight of 402.99 g/mol, XLogP of 4.42, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-[[(3S,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methylsulfanyl]acetamide is sourced from PubChem (CID 11718337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).