About tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate
tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate (PubChem CID 11718462) has the molecular formula C24H28N2O2S
and a molecular weight of 408.57 g/mol. Its IUPAC name is tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate |
| PubChem CID | 11718462 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate |
| SMILES | CSc1ccc2c(c1)c1c(n2C(=O)OC(C)(C)C)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H28N2O2S/c1-24(2,3)28-23(27)26-21-11-10-18(29-4)14-19(21)20-16-25(13-12-22(20)26)15-17-8-6-5-7-9-17/h5-11,14H,12-13,15-16H2,1-4H3 |
| InChIKey | VCQOOMOGVWNNGC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate?
The IUPAC name of tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate (CID 11718462) is tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate.
What is the SMILES notation for tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate?
The canonical SMILES for tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate is CSc1ccc2c(c1)c1c(n2C(=O)OC(C)(C)C)CCN(Cc2ccccc2)C1.
What is the InChIKey of tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate?
The InChIKey is VCQOOMOGVWNNGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O2S/c1-24(2,3)28-23(27)26-21-11-10-18(29-4)14-19(21)20-16-25(13-12-22(20)26)15-17-8-6-5-7-9-17/h5-11,14H,12-13,15-16H2,1-4H3.
What are the key properties of tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate?
tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate has a molecular weight of 408.57 g/mol, XLogP of 5.70, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-benzyl-8-methylsulfanyl-3,4-dihydro-1H-pyrido[4,3-b]indole-5-carboxylate is sourced from PubChem (CID 11718462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).