C17H17NO2 — CID 117185130
3-[(1,5-dimethylindol-3-yl)methoxy]phenol (PubChem CID 117185130) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[(1,5-dimethylindol-3-yl)methoxy]phenol.
| Compound Name | 3-[(1,5-dimethylindol-3-yl)methoxy]phenol |
|---|---|
| PubChem CID | 117185130 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 3-[(1,5-dimethylindol-3-yl)methoxy]phenol |
| SMILES | Cc1ccc2c(c1)c(COc1cccc(O)c1)cn2C |
| InChI | InChI=1S/C17H17NO2/c1-12-6-7-17-16(8-12)13(10-18(17)2)11-20-15-5-3-4-14(19)9-15/h3-10,19H,11H2,1-2H3 |
| InChIKey | NHBWRXDTBNJRKN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |