About 2-(azepan-1-ylmethyl)-1,5-dimethylindole
2-(azepan-1-ylmethyl)-1,5-dimethylindole (PubChem CID 117185359) has the molecular formula C17H24N2
and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-(azepan-1-ylmethyl)-1,5-dimethylindole.
Molecular Properties
| Compound Name | 2-(azepan-1-ylmethyl)-1,5-dimethylindole |
| PubChem CID | 117185359 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-(azepan-1-ylmethyl)-1,5-dimethylindole |
| SMILES | Cc1ccc2c(c1)cc(CN1CCCCCC1)n2C |
| InChI | InChI=1S/C17H24N2/c1-14-7-8-17-15(11-14)12-16(18(17)2)13-19-9-5-3-4-6-10-19/h7-8,11-12H,3-6,9-10,13H2,1-2H3 |
| InChIKey | VRPADCJHVKJVIJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(azepan-1-ylmethyl)-1,5-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azepan-1-ylmethyl)-1,5-dimethylindole?
The IUPAC name of 2-(azepan-1-ylmethyl)-1,5-dimethylindole (CID 117185359) is 2-(azepan-1-ylmethyl)-1,5-dimethylindole.
What is the SMILES notation for 2-(azepan-1-ylmethyl)-1,5-dimethylindole?
The canonical SMILES for 2-(azepan-1-ylmethyl)-1,5-dimethylindole is Cc1ccc2c(c1)cc(CN1CCCCCC1)n2C.
What is the InChIKey of 2-(azepan-1-ylmethyl)-1,5-dimethylindole?
The InChIKey is VRPADCJHVKJVIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2/c1-14-7-8-17-15(11-14)12-16(18(17)2)13-19-9-5-3-4-6-10-19/h7-8,11-12H,3-6,9-10,13H2,1-2H3.
What are the key properties of 2-(azepan-1-ylmethyl)-1,5-dimethylindole?
2-(azepan-1-ylmethyl)-1,5-dimethylindole has a molecular weight of 256.39 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azepan-1-ylmethyl)-1,5-dimethylindole is sourced from PubChem (CID 117185359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).