About [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 11718570) has the molecular formula C24H28N2O2
and a molecular weight of 376.50 g/mol. Its IUPAC name is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| PubChem CID | 11718570 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(O[C@H]1CN2CCC1CC2)N1CCc2ccccc2C1Cc1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c27-24(28-23-17-25-13-10-20(23)11-14-25)26-15-12-19-8-4-5-9-21(19)22(26)16-18-6-2-1-3-7-18/h1-9,20,22-23H,10-17H2/t22?,23-/m0/s1 |
| InChIKey | QVJDPQPQRZODAN-WCSIJFPASA-N |
| XLogP | 4.06 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The IUPAC name of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate (CID 11718570) is [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The canonical SMILES for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate is O=C(O[C@H]1CN2CCC1CC2)N1CCc2ccccc2C1Cc1ccccc1.
What is the InChIKey of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
The InChIKey is QVJDPQPQRZODAN-WCSIJFPASA-N. The full InChI is InChI=1S/C24H28N2O2/c27-24(28-23-17-25-13-10-20(23)11-14-25)26-15-12-19-8-4-5-9-21(19)22(26)16-18-6-2-1-3-7-18/h1-9,20,22-23H,10-17H2/t22?,23-/m0/s1.
What are the key properties of [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate?
[(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate has a molecular weight of 376.50 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-azabicyclo[2.2.2]octan-3-yl] 1-benzyl-3,4-dihydro-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 11718570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).