C22H24N2O4 — CID 11718644
methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylate (PubChem CID 11718644) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylate.
| Compound Name | methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 11718644 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 4-(9H-fluoren-9-ylmethoxycarbonylamino)piperidine-4-carboxylate |
| SMILES | COC(=O)C1(NC(=O)OCC2c3ccccc3-c3ccccc32)CCNCC1 |
| InChI | InChI=1S/C22H24N2O4/c1-27-20(25)22(10-12-23-13-11-22)24-21(26)28-14-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,19,23H,10-14H2,1H3,(H,24,26) |
| InChIKey | LRAJDODFASAYKH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |