About (4-methyl-1,3-oxazol-2-yl)methanethiol
(4-methyl-1,3-oxazol-2-yl)methanethiol (PubChem CID 117186792) has the molecular formula C5H7NOS
and a molecular weight of 129.18 g/mol. Its IUPAC name is (4-methyl-1,3-oxazol-2-yl)methanethiol.
Molecular Properties
| Compound Name | (4-methyl-1,3-oxazol-2-yl)methanethiol |
| PubChem CID | 117186792 |
| Molecular Formula | C5H7NOS |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | (4-methyl-1,3-oxazol-2-yl)methanethiol |
| SMILES | Cc1coc(CS)n1 |
| InChI | InChI=1S/C5H7NOS/c1-4-2-7-5(3-8)6-4/h2,8H,3H2,1H3 |
| InChIKey | YHRLMOAMJFDZHH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-1,3-oxazol-2-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-1,3-oxazol-2-yl)methanethiol?
The IUPAC name of (4-methyl-1,3-oxazol-2-yl)methanethiol (CID 117186792) is (4-methyl-1,3-oxazol-2-yl)methanethiol.
What is the SMILES notation for (4-methyl-1,3-oxazol-2-yl)methanethiol?
The canonical SMILES for (4-methyl-1,3-oxazol-2-yl)methanethiol is Cc1coc(CS)n1.
What is the InChIKey of (4-methyl-1,3-oxazol-2-yl)methanethiol?
The InChIKey is YHRLMOAMJFDZHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NOS/c1-4-2-7-5(3-8)6-4/h2,8H,3H2,1H3.
What are the key properties of (4-methyl-1,3-oxazol-2-yl)methanethiol?
(4-methyl-1,3-oxazol-2-yl)methanethiol has a molecular weight of 129.18 g/mol, XLogP of 1.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-1,3-oxazol-2-yl)methanethiol is sourced from PubChem (CID 117186792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).