C12H13NO2S — CID 117188251
2-[(3-methoxyphenoxy)methyl]-5-methyl-1,3-thiazole (PubChem CID 117188251) has the molecular formula C12H13NO2S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[(3-methoxyphenoxy)methyl]-5-methyl-1,3-thiazole.
| Compound Name | 2-[(3-methoxyphenoxy)methyl]-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 117188251 |
| Molecular Formula | C12H13NO2S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-[(3-methoxyphenoxy)methyl]-5-methyl-1,3-thiazole |
| SMILES | COc1cccc(OCc2ncc(C)s2)c1 |
| InChI | InChI=1S/C12H13NO2S/c1-9-7-13-12(16-9)8-15-11-5-3-4-10(6-11)14-2/h3-7H,8H2,1-2H3 |
| InChIKey | KLALBJMIKHITSO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |