C27H25ClN2O — CID 11718901
1-[(1S)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one (PubChem CID 11718901) has the molecular formula C27H25ClN2O and a molecular weight of 428.96 g/mol. Its IUPAC name is 1-[(1S)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[(1S)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 11718901 |
| Molecular Formula | C27H25ClN2O |
| Molecular Weight | 428.96 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 1-[(1S)-6-chloro-1-(4-methylphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-3-phenylpropan-1-one |
| SMILES | Cc1ccc([C@H]2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H25ClN2O/c1-18-7-10-20(11-8-18)27-26-22(23-17-21(28)12-13-24(23)29-26)15-16-30(27)25(31)14-9-19-5-3-2-4-6-19/h2-8,10-13,17,27,29H,9,14-16H2,1H3/t27-/m0/s1 |
| InChIKey | VQGQJBNCAQWQGJ-MHZLTWQESA-N |
| XLogP | 6.24 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.96 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|