About 2-(3-chlorophenoxy)-1,3-thiazol-4-amine
2-(3-chlorophenoxy)-1,3-thiazol-4-amine (PubChem CID 117189228) has the molecular formula C9H7ClN2OS
and a molecular weight of 226.69 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-(3-chlorophenoxy)-1,3-thiazol-4-amine |
| PubChem CID | 117189228 |
| Molecular Formula | C9H7ClN2OS |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 2-(3-chlorophenoxy)-1,3-thiazol-4-amine |
| SMILES | Nc1csc(Oc2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C9H7ClN2OS/c10-6-2-1-3-7(4-6)13-9-12-8(11)5-14-9/h1-5H,11H2 |
| InChIKey | QQHJUSODTPIFOZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chlorophenoxy)-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenoxy)-1,3-thiazol-4-amine?
The IUPAC name of 2-(3-chlorophenoxy)-1,3-thiazol-4-amine (CID 117189228) is 2-(3-chlorophenoxy)-1,3-thiazol-4-amine.
What is the SMILES notation for 2-(3-chlorophenoxy)-1,3-thiazol-4-amine?
The canonical SMILES for 2-(3-chlorophenoxy)-1,3-thiazol-4-amine is Nc1csc(Oc2cccc(Cl)c2)n1.
What is the InChIKey of 2-(3-chlorophenoxy)-1,3-thiazol-4-amine?
The InChIKey is QQHJUSODTPIFOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2OS/c10-6-2-1-3-7(4-6)13-9-12-8(11)5-14-9/h1-5H,11H2.
What are the key properties of 2-(3-chlorophenoxy)-1,3-thiazol-4-amine?
2-(3-chlorophenoxy)-1,3-thiazol-4-amine has a molecular weight of 226.69 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenoxy)-1,3-thiazol-4-amine is sourced from PubChem (CID 117189228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).