About 2-N-ethyl-1,3-thiazole-2,4-diamine
2-N-ethyl-1,3-thiazole-2,4-diamine (PubChem CID 117189257) has the molecular formula C5H9N3S
and a molecular weight of 143.22 g/mol. Its IUPAC name is 2-N-ethyl-1,3-thiazole-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-ethyl-1,3-thiazole-2,4-diamine |
| PubChem CID | 117189257 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 2-N-ethyl-1,3-thiazole-2,4-diamine |
| SMILES | CCNc1nc(N)cs1 |
| InChI | InChI=1S/C5H9N3S/c1-2-7-5-8-4(6)3-9-5/h3H,2,6H2,1H3,(H,7,8) |
| InChIKey | JFSWOKHKFCZSOA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-ethyl-1,3-thiazole-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-ethyl-1,3-thiazole-2,4-diamine?
The IUPAC name of 2-N-ethyl-1,3-thiazole-2,4-diamine (CID 117189257) is 2-N-ethyl-1,3-thiazole-2,4-diamine.
What is the SMILES notation for 2-N-ethyl-1,3-thiazole-2,4-diamine?
The canonical SMILES for 2-N-ethyl-1,3-thiazole-2,4-diamine is CCNc1nc(N)cs1.
What is the InChIKey of 2-N-ethyl-1,3-thiazole-2,4-diamine?
The InChIKey is JFSWOKHKFCZSOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S/c1-2-7-5-8-4(6)3-9-5/h3H,2,6H2,1H3,(H,7,8).
What are the key properties of 2-N-ethyl-1,3-thiazole-2,4-diamine?
2-N-ethyl-1,3-thiazole-2,4-diamine has a molecular weight of 143.22 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-ethyl-1,3-thiazole-2,4-diamine is sourced from PubChem (CID 117189257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).