C19H19F6N5 — CID 11718961
(1R,6S)-3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-amine (PubChem CID 11718961) has the molecular formula C19H19F6N5 and a molecular weight of 431.38 g/mol. Its IUPAC name is (1R,6S)-3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-amine.
| Compound Name | (1R,6S)-3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 11718961 |
| Molecular Formula | C19H19F6N5 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | (1R,6S)-3-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]-6-(2,4,5-trifluorophenyl)cyclohex-3-en-1-amine |
| SMILES | N[C@@H]1CC(CN2CCn3c(nnc3C(F)(F)F)C2)=CC[C@H]1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C19H19F6N5/c20-13-7-15(22)14(21)6-12(13)11-2-1-10(5-16(11)26)8-29-3-4-30-17(9-29)27-28-18(30)19(23,24)25/h1,6-7,11,16H,2-5,8-9,26H2/t11-,16+/m0/s1 |
| InChIKey | MXJUMTMNYKDOGJ-MEDUHNTESA-N |
| XLogP | 3.36 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|