About 5-bromo-2-methoxy-1,3-oxazole
5-bromo-2-methoxy-1,3-oxazole (PubChem CID 117190136) has the molecular formula C4H4BrNO2
and a molecular weight of 177.98 g/mol. Its IUPAC name is 5-bromo-2-methoxy-1,3-oxazole.
Molecular Properties
| Compound Name | 5-bromo-2-methoxy-1,3-oxazole |
| PubChem CID | 117190136 |
| Molecular Formula | C4H4BrNO2 |
| Molecular Weight | 177.98 g/mol |
| Exact Mass | 176.94 |
| IUPAC Name | 5-bromo-2-methoxy-1,3-oxazole |
| SMILES | COc1ncc(Br)o1 |
| InChI | InChI=1S/C4H4BrNO2/c1-7-4-6-2-3(5)8-4/h2H,1H3 |
| InChIKey | YGAMQABWCCSSTK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.98 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-methoxy-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methoxy-1,3-oxazole?
The IUPAC name of 5-bromo-2-methoxy-1,3-oxazole (CID 117190136) is 5-bromo-2-methoxy-1,3-oxazole.
What is the SMILES notation for 5-bromo-2-methoxy-1,3-oxazole?
The canonical SMILES for 5-bromo-2-methoxy-1,3-oxazole is COc1ncc(Br)o1.
What is the InChIKey of 5-bromo-2-methoxy-1,3-oxazole?
The InChIKey is YGAMQABWCCSSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrNO2/c1-7-4-6-2-3(5)8-4/h2H,1H3.
What are the key properties of 5-bromo-2-methoxy-1,3-oxazole?
5-bromo-2-methoxy-1,3-oxazole has a molecular weight of 177.98 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methoxy-1,3-oxazole is sourced from PubChem (CID 117190136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).