About 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one
3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one (PubChem CID 11719060) has the molecular formula C26H24N6O
and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one |
| PubChem CID | 11719060 |
| Molecular Formula | C26H24N6O |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]ccc2nc(-c3ccc(CNCCCn4ccnn4)cc3)c(-c3ccccc3)cc12 |
| InChI | InChI=1S/C26H24N6O/c33-26-23-17-22(20-5-2-1-3-6-20)25(30-24(23)11-13-28-26)21-9-7-19(8-10-21)18-27-12-4-15-32-16-14-29-31-32/h1-3,5-11,13-14,16-17,27H,4,12,15,18H2,(H,28,33) |
| InChIKey | ADXYPVNUVWOAFP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one?
The IUPAC name of 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one (CID 11719060) is 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one.
What is the SMILES notation for 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one?
The canonical SMILES for 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one is O=c1[nH]ccc2nc(-c3ccc(CNCCCn4ccnn4)cc3)c(-c3ccccc3)cc12.
What is the InChIKey of 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one?
The InChIKey is ADXYPVNUVWOAFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N6O/c33-26-23-17-22(20-5-2-1-3-6-20)25(30-24(23)11-13-28-26)21-9-7-19(8-10-21)18-27-12-4-15-32-16-14-29-31-32/h1-3,5-11,13-14,16-17,27H,4,12,15,18H2,(H,28,33).
What are the key properties of 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one?
3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one has a molecular weight of 436.52 g/mol, XLogP of 4.03, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2-[4-[[3-(triazol-1-yl)propylamino]methyl]phenyl]-6H-1,6-naphthyridin-5-one is sourced from PubChem (CID 11719060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).