C11H12N2O4S — CID 117191181
4-[(3-methoxyphenoxy)methyl]-1,1-dioxo-1,3-thiazol-2-amine (PubChem CID 117191181) has the molecular formula C11H12N2O4S and a molecular weight of 268.29 g/mol. Its IUPAC name is 4-[(3-methoxyphenoxy)methyl]-1,1-dioxo-1,3-thiazol-2-amine.
| Compound Name | 4-[(3-methoxyphenoxy)methyl]-1,1-dioxo-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 117191181 |
| Molecular Formula | C11H12N2O4S |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 4-[(3-methoxyphenoxy)methyl]-1,1-dioxo-1,3-thiazol-2-amine |
| SMILES | COc1cccc(OCC2=CS(=O)(=O)C(N)=N2)c1 |
| InChI | InChI=1S/C11H12N2O4S/c1-16-9-3-2-4-10(5-9)17-6-8-7-18(14,15)11(12)13-8/h2-5,7H,6H2,1H3,(H2,12,13) |
| InChIKey | FKEKFNSFECKJFZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |