About 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine
1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine (PubChem CID 117191232) has the molecular formula C7H12N2O3S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine |
| PubChem CID | 117191232 |
| Molecular Formula | C7H12N2O3S |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine |
| SMILES | CC(C)OCC1=CS(=O)(=O)C(N)=N1 |
| InChI | InChI=1S/C7H12N2O3S/c1-5(2)12-3-6-4-13(10,11)7(8)9-6/h4-5H,3H2,1-2H3,(H2,8,9) |
| InChIKey | FIGGGNMAGJWDAK-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine?
The IUPAC name of 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine (CID 117191232) is 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine is CC(C)OCC1=CS(=O)(=O)C(N)=N1.
What is the InChIKey of 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine?
The InChIKey is FIGGGNMAGJWDAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S/c1-5(2)12-3-6-4-13(10,11)7(8)9-6/h4-5H,3H2,1-2H3,(H2,8,9).
What are the key properties of 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine?
1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine has a molecular weight of 204.25 g/mol, XLogP of -0.00, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxo-4-(propan-2-yloxymethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 117191232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).